CAS 2923227-94-3 is the registry number for 7-Bromo-6-chloro-2,3-dihydrobenzofuran-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-6-chloro-2,3-dihydro-1-benzofuran-5-amine (CAS 2923227-94-3) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: 7-bromo-6-chloro-2,3-dihydro-1-benzofuran-5-amine. InChIKey: DNSIOVABAYMMKN-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | 7-bromo-6-chloro-2,3-dihydro-1-benzofuran-5-amine |
| InChIKey | DNSIOVABAYMMKN-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C(=C(C=C21)N)Cl)Br |
Computed by PubChem (NCBI)