Products 2925092-45-9
CAS 2925092-45-9 is the registry number for 3-{6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl}piperidine-2,6-dione. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-(6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-2,6-dione (CAS 2925092-45-9) is a chemical compound with the molecular formula C11H9BrN4O2 and a molecular weight of 309.12 g/mol. IUPAC name: 3-(6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-2,6-dione. InChIKey: MBACEKMVUDPVFT-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN4O2 |
|---|---|
| Molecular weight | 309.12 g/mol |
| IUPAC name | 3-(6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-2,6-dione |
| InChIKey | MBACEKMVUDPVFT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=NN=C3N2C=C(C=C3)Br |
Computed by PubChem (NCBI)