Products 2925094-07-9
CAS 2925094-07-9 is the registry number for 1-{6-bromoimidazo[1,2-a]pyridin-3-yl}-1,3-diazinane-2,4-dione. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1,3-diazinane-2,4-dione (CAS 2925094-07-9) is a chemical compound with the molecular formula C11H9BrN4O2 and a molecular weight of 309.12 g/mol. IUPAC name: 1-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1,3-diazinane-2,4-dione. InChIKey: NQHPJTKCSQEPDN-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN4O2 |
|---|---|
| Molecular weight | 309.12 g/mol |
| IUPAC name | 1-(6-bromoimidazo[1,2-a]pyridin-3-yl)-1,3-diazinane-2,4-dione |
| InChIKey | NQHPJTKCSQEPDN-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CN=C3N2C=C(C=C3)Br |
Computed by PubChem (NCBI)