Products 2925094-77-3
CAS 2925094-77-3 is the registry number for CRBN ligand-665. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[6-(2,4-dioxo-1,3-diazinan-1-yl)indazol-2-yl]acetic acid (CAS 2925094-77-3) is a chemical compound with the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. IUPAC name: 2-[6-(2,4-dioxo-1,3-diazinan-1-yl)indazol-2-yl]acetic acid. InChIKey: BSVYKFQWFOORTG-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O4 |
|---|---|
| Molecular weight | 288.26 g/mol |
| IUPAC name | 2-[6-(2,4-dioxo-1,3-diazinan-1-yl)indazol-2-yl]acetic acid |
| InChIKey | BSVYKFQWFOORTG-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC3=NN(C=C3C=C2)CC(=O)O |
Computed by PubChem (NCBI)