Products 2925098-56-0
CAS 2925098-56-0 is the registry number for CRBN ligand-481. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(5-bromo-1-methylindol-7-yl)-1,3-diazinane-2,4-dione (CAS 2925098-56-0) is a chemical compound with the molecular formula C13H12BrN3O2 and a molecular weight of 322.16 g/mol. IUPAC name: 1-(5-bromo-1-methylindol-7-yl)-1,3-diazinane-2,4-dione. InChIKey: SXQVPVSKEHEMRM-UHFFFAOYSA-N.
| Molecular formula | C13H12BrN3O2 |
|---|---|
| Molecular weight | 322.16 g/mol |
| IUPAC name | 1-(5-bromo-1-methylindol-7-yl)-1,3-diazinane-2,4-dione |
| InChIKey | SXQVPVSKEHEMRM-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=CC(=CC(=C21)N3CCC(=O)NC3=O)Br |
Computed by PubChem (NCBI)