Products 2925100-26-9
CAS 2925100-26-9 is the registry number for CRBN ligand-662. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[5-(2,4-dioxo-1,3-diazinan-1-yl)indazol-1-yl]acetic acid (CAS 2925100-26-9) is a chemical compound with the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. IUPAC name: 2-[5-(2,4-dioxo-1,3-diazinan-1-yl)indazol-1-yl]acetic acid. InChIKey: CAXLMQWRRLSIJQ-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O4 |
|---|---|
| Molecular weight | 288.26 g/mol |
| IUPAC name | 2-[5-(2,4-dioxo-1,3-diazinan-1-yl)indazol-1-yl]acetic acid |
| InChIKey | CAXLMQWRRLSIJQ-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC3=C(C=C2)N(N=C3)CC(=O)O |
Computed by PubChem (NCBI)