Products 2925102-47-0
CAS 2925102-47-0 is the registry number for CRBN ligand-550. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(2,4-dioxo-1,3-diazinan-1-yl)quinazoline-2-carboxylic acid (CAS 2925102-47-0) is a chemical compound with the molecular formula C13H10N4O4 and a molecular weight of 286.24 g/mol. IUPAC name: 5-(2,4-dioxo-1,3-diazinan-1-yl)quinazoline-2-carboxylic acid. InChIKey: VAXWFIQCKKIAJB-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O4 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | 5-(2,4-dioxo-1,3-diazinan-1-yl)quinazoline-2-carboxylic acid |
| InChIKey | VAXWFIQCKKIAJB-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC=CC3=NC(=NC=C32)C(=O)O |
Computed by PubChem (NCBI)