Products 2925321-33-9
CAS 2925321-33-9 is the registry number for 5-(2,2-Dimethylpropyl)-2-(4-methylphenyl)pyridine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(2,2-dimethylpropyl)-2-(4-methylphenyl)pyridine (CAS 2925321-33-9) is a chemical compound with the molecular formula C17H21N and a molecular weight of 239.35 g/mol. IUPAC name: 5-(2,2-dimethylpropyl)-2-(4-methylphenyl)pyridine. InChIKey: SOPGBGVTPLABEK-UHFFFAOYSA-N.
| Molecular formula | C17H21N |
|---|---|
| Molecular weight | 239.35 g/mol |
| IUPAC name | 5-(2,2-dimethylpropyl)-2-(4-methylphenyl)pyridine |
| InChIKey | SOPGBGVTPLABEK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC=C(C=C2)CC(C)(C)C |
Computed by PubChem (NCBI)