Products 2925379-35-5

CAS 2925379-35-5 is the registry number for 4-(Bromomethyl)-2-(tert-butyl)thiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(bromomethyl)-2-tert-butyl-1,3-thiazole-5-carboxylic acid (CAS 2925379-35-5) is a chemical compound with the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. IUPAC name: 4-(bromomethyl)-2-tert-butyl-1,3-thiazole-5-carboxylic acid. InChIKey: FAUXOCQXFKBPEK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12BrNO2S
Molecular weight278.17 g/mol
IUPAC name4-(bromomethyl)-2-tert-butyl-1,3-thiazole-5-carboxylic acid
InChIKeyFAUXOCQXFKBPEK-UHFFFAOYSA-N
SMILESCC(C)(C)C1=NC(=C(S1)C(=O)O)CBr

Computed by PubChem (NCBI)