CAS 2925379-36-6 is the registry number for 7-Bromo-5-chloro-[1,2,4]triazolo[4,3-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-5-chloro-[1,2,4]triazolo[4,3-a]pyridine (CAS 2925379-36-6) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 7-bromo-5-chloro-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: FGBPEJXAHIFKPL-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 7-bromo-5-chloro-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | FGBPEJXAHIFKPL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N2C1=NN=C2)Cl)Br |
Computed by PubChem (NCBI)