CAS 29266-16-8 is the registry number for (E)-Ethyl 3-(2-methyl-1H-indol-3-yl)acrylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (E)-3-(2-methyl-1H-indol-3-yl)prop-2-enoate (CAS 29266-16-8) is a chemical compound with the molecular formula C14H15NO2 and a molecular weight of 229.27 g/mol. IUPAC name: ethyl (E)-3-(2-methyl-1H-indol-3-yl)prop-2-enoate. InChIKey: YCWFVSKTQYNIFA-CMDGGOBGSA-N.
| Molecular formula | C14H15NO2 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | ethyl (E)-3-(2-methyl-1H-indol-3-yl)prop-2-enoate |
| InChIKey | YCWFVSKTQYNIFA-CMDGGOBGSA-N |
| SMILES | CCOC(=O)/C=C/C1=C(NC2=CC=CC=C21)C |
Computed by PubChem (NCBI)