CAS 2927440-63-7 is the registry number for ((2S,7AR)-2-fluoro-5-methyltetrahydro-1H-pyrrolizin-7a(5H)-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,8R)-2-fluoro-5-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (CAS 2927440-63-7) is a chemical compound with the molecular formula C9H16FNO and a molecular weight of 173.23 g/mol. IUPAC name: [(2S,8R)-2-fluoro-5-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol. InChIKey: JNALTWHBNAXBIO-SXNZSPLWSA-N.
| Molecular formula | C9H16FNO |
|---|---|
| Molecular weight | 173.23 g/mol |
| IUPAC name | [(2S,8R)-2-fluoro-5-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| InChIKey | JNALTWHBNAXBIO-SXNZSPLWSA-N |
| SMILES | CC1CC[C@]2(N1C[C@H](C2)F)CO |
Computed by PubChem (NCBI)