CAS 2454397-94-3 is the registry number for ((1S,3S,4R)-2-(2-Fluoroethyl)-2-azabicyclo[2.2.1]heptan-3-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,3S,4R)-2-(2-fluoroethyl)-2-azabicyclo[2.2.1]heptan-3-yl]methanol (CAS 2454397-94-3) is a chemical compound with the molecular formula C9H16FNO and a molecular weight of 173.23 g/mol. IUPAC name: [(1S,3S,4R)-2-(2-fluoroethyl)-2-azabicyclo[2.2.1]heptan-3-yl]methanol. InChIKey: CUCDYIPRVFZEIU-HRDYMLBCSA-N.
| Molecular formula | C9H16FNO |
|---|---|
| Molecular weight | 173.23 g/mol |
| IUPAC name | [(1S,3S,4R)-2-(2-fluoroethyl)-2-azabicyclo[2.2.1]heptan-3-yl]methanol |
| InChIKey | CUCDYIPRVFZEIU-HRDYMLBCSA-N |
| SMILES | C1C[C@H]2C[C@@H]1[C@H](N2CCF)CO |
Computed by PubChem (NCBI)