CAS 2758756-44-2 is the registry number for ((2R,8AS)-2-fluorohexahydroindolizin-8a(1H)-yl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,8aS)-2-fluoro-2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl]methanol (CAS 2758756-44-2) is a chemical compound with the molecular formula C9H16FNO and a molecular weight of 173.23 g/mol. IUPAC name: [(2R,8aS)-2-fluoro-2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl]methanol. InChIKey: KHJIAOCBKYHZQF-BDAKNGLRSA-N.
| Molecular formula | C9H16FNO |
|---|---|
| Molecular weight | 173.23 g/mol |
| IUPAC name | [(2R,8aS)-2-fluoro-2,3,5,6,7,8-hexahydro-1H-indolizin-8a-yl]methanol |
| InChIKey | KHJIAOCBKYHZQF-BDAKNGLRSA-N |
| SMILES | C1CCN2C[C@@H](C[C@@]2(C1)CO)F |
Computed by PubChem (NCBI)