Products 2933208-75-2
CAS 2933208-75-2 is the registry number for 7-Methoxy-2,8-dimethylimidazo[1,2-a]pyridine-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methoxy-2,8-dimethylimidazo[1,2-a]pyridine-6-carboxylic acid (CAS 2933208-75-2) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 7-methoxy-2,8-dimethylimidazo[1,2-a]pyridine-6-carboxylic acid. InChIKey: MOKZWBRELMPXKC-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 7-methoxy-2,8-dimethylimidazo[1,2-a]pyridine-6-carboxylic acid |
| InChIKey | MOKZWBRELMPXKC-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(C(=C(C2=N1)C)OC)C(=O)O |
Computed by PubChem (NCBI)