Products 2933217-24-2
CAS 2933217-24-2 is the registry number for 2-(tert-Butyl) 3-methyl (3S,5S)-6-oxo-2,7-diazaspiro[4.4]nonane-2,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-O-tert-butyl 8-O-methyl (5S,8S)-1-oxo-2,7-diazaspiro[4.4]nonane-7,8-dicarboxylate (CAS 2933217-24-2) is a chemical compound with the molecular formula C14H22N2O5 and a molecular weight of 298.33 g/mol. IUPAC name: 7-O-tert-butyl 8-O-methyl (5S,8S)-1-oxo-2,7-diazaspiro[4.4]nonane-7,8-dicarboxylate. InChIKey: CRXBILNSBVZTJM-XPTSAGLGSA-N.
| Molecular formula | C14H22N2O5 |
|---|---|
| Molecular weight | 298.33 g/mol |
| IUPAC name | 7-O-tert-butyl 8-O-methyl (5S,8S)-1-oxo-2,7-diazaspiro[4.4]nonane-7,8-dicarboxylate |
| InChIKey | CRXBILNSBVZTJM-XPTSAGLGSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@]2(CCNC2=O)C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)