CAS 1357351-87-1 appears in our catalog under these names: 2-tert-Butyl 5-ethyl 7-oxo-2,6-diazaspiro[3.4]octane-2,5-dicarboxylate, 95%, 2-tert-Butyl 5-ethyl 7-oxo-2,6-diazaspiro(3.4)octane-2,5-dicarboxylate, 97%, 2-tert-butyl 5-ethyl 7-oxo-2,6-diazaspiro(3.4)octane-2,5-dicarboxylate, 2-tert-butyl 5-ethyl 7-oxo-2,6-diazaspiro[3.4]octane-2,5-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 0,5g, 50mg, 100mg, 500mg.
2-O-tert-butyl 5-O-ethyl 7-oxo-2,6-diazaspiro[3.4]octane-2,5-dicarboxylate (CAS 1357351-87-1) is a chemical compound with the molecular formula C14H22N2O5 and a molecular weight of 298.33 g/mol. IUPAC name: 2-O-tert-butyl 5-O-ethyl 7-oxo-2,6-diazaspiro[3.4]octane-2,5-dicarboxylate. InChIKey: HVOJRYNWIYULON-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O5 |
|---|---|
| Molecular weight | 298.33 g/mol |
| IUPAC name | 2-O-tert-butyl 5-O-ethyl 7-oxo-2,6-diazaspiro[3.4]octane-2,5-dicarboxylate |
| InChIKey | HVOJRYNWIYULON-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C2(CC(=O)N1)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)