CAS 1827680-33-0 is the registry number for 1-(tert-Butyl) 2-methyl (R,E)-3-((dimethylamino)methylene)-4-oxopyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 2-O-methyl 3-(dimethylaminomethylidene)-4-oxopyrrolidine-1,2-dicarboxylate (CAS 1827680-33-0) is a chemical compound with the molecular formula C14H22N2O5 and a molecular weight of 298.33 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 3-(dimethylaminomethylidene)-4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: HPJJHRRILIOMAR-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O5 |
|---|---|
| Molecular weight | 298.33 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 3-(dimethylaminomethylidene)-4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | HPJJHRRILIOMAR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)C(=CN(C)C)C1C(=O)OC |
Computed by PubChem (NCBI)