CAS 1824081-61-9 appears in our catalog under these names: 7-(tert-Butyl) 3-ethyl 1-oxa-2,7-diazaspiro(4.4)non-2-ene-3,7-dicarboxylate, 98%, 7-tert-butyl 3-ethyl 1-oxa-2,7-diazaspiro[4.4]non-2-ene-3,7-dicarboxylate, 97%, 97%, O7-TERT-BUTYL O3-ETHYL 1-OXA-2,7-DIAZASPIRO[4.4]NON-2-ENE-3,7-DICARBOXYLATE, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
7-O-tert-butyl 3-O-ethyl 1-oxa-2,7-diazaspiro[4.4]non-2-ene-3,7-dicarboxylate (CAS 1824081-61-9) is a chemical compound with the molecular formula C14H22N2O5 and a molecular weight of 298.33 g/mol. IUPAC name: 7-O-tert-butyl 3-O-ethyl 1-oxa-2,7-diazaspiro[4.4]non-2-ene-3,7-dicarboxylate. InChIKey: JJONPLXCFHTZMO-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O5 |
|---|---|
| Molecular weight | 298.33 g/mol |
| IUPAC name | 7-O-tert-butyl 3-O-ethyl 1-oxa-2,7-diazaspiro[4.4]non-2-ene-3,7-dicarboxylate |
| InChIKey | JJONPLXCFHTZMO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC2(C1)CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)