CAS 293330-11-7 appears in our catalog under these names: 3-(3,5-Dimethylphenyl)-beta-alanine, 96%, 3-Amino-2-(3,5-dimethylphenyl)propanoic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g, 250mg.
3-amino-3-(3,5-dimethylphenyl)propanoic acid (CAS 293330-11-7) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 3-amino-3-(3,5-dimethylphenyl)propanoic acid. InChIKey: YBIJIOITROSVBG-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 3-amino-3-(3,5-dimethylphenyl)propanoic acid |
| InChIKey | YBIJIOITROSVBG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(CC(=O)O)N)C |
Computed by PubChem (NCBI)