CAS 29368-40-9 is the registry number for p38-α MAPK-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(4-chloro-3-nitrophenyl)-1-phenylprop-2-en-1-one (CAS 29368-40-9) is a chemical compound with the molecular formula C15H10ClNO3 and a molecular weight of 287.70 g/mol. IUPAC name: (E)-3-(4-chloro-3-nitrophenyl)-1-phenylprop-2-en-1-one. InChIKey: BUBKYHHYGUMLHF-VQHVLOKHSA-N.
| Molecular formula | C15H10ClNO3 |
|---|---|
| Molecular weight | 287.70 g/mol |
| IUPAC name | (E)-3-(4-chloro-3-nitrophenyl)-1-phenylprop-2-en-1-one |
| InChIKey | BUBKYHHYGUMLHF-VQHVLOKHSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C/C2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)