CAS 51234-85-6 appears in our catalog under these names: a-Desmethyl Benoxaprofen, Alpha-Desmethyl Benoxaprofen. Offered by: TRC. Available pack sizes: 100mg, 25mg, 5mg.
2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetic acid (CAS 51234-85-6) is a chemical compound with the molecular formula C15H10ClNO3 and a molecular weight of 287.70 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetic acid. InChIKey: MQBAVJCSIXDBPU-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO3 |
|---|---|
| Molecular weight | 287.70 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]acetic acid |
| InChIKey | MQBAVJCSIXDBPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(O2)C=CC(=C3)CC(=O)O)Cl |
Computed by PubChem (NCBI)