Products 588676-14-6

CAS 588676-14-6 is the registry number for 8-Chloro-2-(5-methyl-2-furyl)quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

8-chloro-2-(5-methylfuran-2-yl)quinoline-4-carboxylic acid (CAS 588676-14-6) is a chemical compound with the molecular formula C15H10ClNO3 and a molecular weight of 287.70 g/mol. IUPAC name: 8-chloro-2-(5-methylfuran-2-yl)quinoline-4-carboxylic acid. InChIKey: NNNHXSKERHVLHI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H10ClNO3
Molecular weight287.70 g/mol
IUPAC name8-chloro-2-(5-methylfuran-2-yl)quinoline-4-carboxylic acid
InChIKeyNNNHXSKERHVLHI-UHFFFAOYSA-N
SMILESCC1=CC=C(O1)C2=NC3=C(C=CC=C3Cl)C(=C2)C(=O)O

Computed by PubChem (NCBI)