Products 29372-29-0
CAS 29372-29-0 appears in our catalog under these names: 4-Methylpyridine-d7, 98 atom % D, min 98% Chemical Purity, 4–METHYLPYRIDINE–D7. Offered by: CDN, GLPBio. Available pack sizes: 1g, 0,5g, 10mg.
2,3,5,6-tetradeuterio-4-(trideuteriomethyl)pyridine (CAS 29372-29-0) is a chemical compound with the molecular formula C6H7N and a molecular weight of 100.17 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(trideuteriomethyl)pyridine. InChIKey: FKNQCJSGGFJEIZ-AAYPNNLASA-N.
| Molecular formula | C6H7N |
|---|---|
| Molecular weight | 100.17 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(trideuteriomethyl)pyridine |
| InChIKey | FKNQCJSGGFJEIZ-AAYPNNLASA-N |
| SMILES | [2H]C1=C(N=C(C(=C1C([2H])([2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)