CAS 29375-30-2 appears in our catalog under these names: (S)-tert-Butyl 1-((S)-2-aminopropanoyl)pyrrolidine-2-carboxylate, 97%, L-Alanyl-L-proline tert-butyl ester. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10g, 5g, 25g.
Tert-butyl (2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carboxylate (CAS 29375-30-2) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: tert-butyl (2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carboxylate. InChIKey: GEMSXPOJLIUVKT-IUCAKERBSA-N.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | tert-butyl (2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carboxylate |
| InChIKey | GEMSXPOJLIUVKT-IUCAKERBSA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)