Products 29378-70-9
CAS 29378-70-9 is the registry number for 3-(Broacetyl)aminophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-N-(3-hydroxyphenyl)acetamide (CAS 29378-70-9) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-bromo-N-(3-hydroxyphenyl)acetamide. InChIKey: GLFLQHRNECEYSQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-bromo-N-(3-hydroxyphenyl)acetamide |
| InChIKey | GLFLQHRNECEYSQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)NC(=O)CBr |
Computed by PubChem (NCBI)