Products 2938170-12-6
CAS 2938170-12-6 is the registry number for (R)-2-Amino-3-cyano-4-methyl-4,5,6,7-tetrahydrobenzo[b]thiophene-4-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4R)-2-amino-3-cyano-4-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid (CAS 2938170-12-6) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: (4R)-2-amino-3-cyano-4-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid. InChIKey: IITRDERXWQUMAG-LLVKDONJSA-N.
| Molecular formula | C11H12N2O2S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | (4R)-2-amino-3-cyano-4-methyl-6,7-dihydro-5H-1-benzothiophene-4-carboxylic acid |
| InChIKey | IITRDERXWQUMAG-LLVKDONJSA-N |
| SMILES | C[C@]1(CCCC2=C1C(=C(S2)N)C#N)C(=O)O |
Computed by PubChem (NCBI)