CAS 2940857-07-6 is the registry number for tert-butyl N-[(2R,3R)-2-(hydroxymethyl)tetrahydrofuran-3-yl]carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2R,3R)-2-(hydroxymethyl)oxolan-3-yl]carbamate (CAS 2940857-07-6) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl N-[(2R,3R)-2-(hydroxymethyl)oxolan-3-yl]carbamate. InChIKey: SYDRTOIJBNFWGE-SFYZADRCSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl N-[(2R,3R)-2-(hydroxymethyl)oxolan-3-yl]carbamate |
| InChIKey | SYDRTOIJBNFWGE-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCO[C@H]1CO |
Computed by PubChem (NCBI)