Products 2940859-48-1
CAS 2940859-48-1 is the registry number for tert-butyl N-[(3R)-7-oxoazepan-3-yl]carbamate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Tert-butyl N-[(3R)-7-oxoazepan-3-yl]carbamate (CAS 2940859-48-1) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl N-[(3R)-7-oxoazepan-3-yl]carbamate. InChIKey: AMAPJMDITRSEMN-MRVPVSSYSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl N-[(3R)-7-oxoazepan-3-yl]carbamate |
| InChIKey | AMAPJMDITRSEMN-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC(=O)NC1 |
Computed by PubChem (NCBI)