Products 2940860-95-5
CAS 2940860-95-5 is the registry number for (S)-1-Methyl-7-(trifluoromethyl)-1H-pyrano[4,3-c]pyridin-4(3H)-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(1S)-1-methyl-7-(trifluoromethyl)-1H-pyrano[4,3-c]pyridin-4-one (CAS 2940860-95-5) is a chemical compound with the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. IUPAC name: (1S)-1-methyl-7-(trifluoromethyl)-1H-pyrano[4,3-c]pyridin-4-one. InChIKey: RNUHAHITXATNSH-YFKPBYRVSA-N.
| Molecular formula | C10H8F3NO2 |
|---|---|
| Molecular weight | 231.17 g/mol |
| IUPAC name | (1S)-1-methyl-7-(trifluoromethyl)-1H-pyrano[4,3-c]pyridin-4-one |
| InChIKey | RNUHAHITXATNSH-YFKPBYRVSA-N |
| SMILES | C[C@H]1C2=CC(=NC=C2C(=O)CO1)C(F)(F)F |
Computed by PubChem (NCBI)