Products 2940869-68-9
CAS 2940869-68-9 is the registry number for tert-butyl N-[(4R)-2-oxoazepan-4-yl]carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(4R)-2-oxoazepan-4-yl]carbamate (CAS 2940869-68-9) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl N-[(4R)-2-oxoazepan-4-yl]carbamate. InChIKey: OSAXWHKEQRUBFV-MRVPVSSYSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl N-[(4R)-2-oxoazepan-4-yl]carbamate |
| InChIKey | OSAXWHKEQRUBFV-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCNC(=O)C1 |
Computed by PubChem (NCBI)