CAS 2940874-41-7 appears in our catalog under these names: (R)-2-Amino-2-cycloheptylacetic acid hydrochloride, 98%, (2R)-2-amino-2-cycloheptyl-acetic acid,hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(2R)-2-amino-2-cycloheptylacetic acid;hydrochloride (CAS 2940874-41-7) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: (2R)-2-amino-2-cycloheptylacetic acid;hydrochloride. InChIKey: FOHHHWQTBPZFAO-DDWIOCJRSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (2R)-2-amino-2-cycloheptylacetic acid;hydrochloride |
| InChIKey | FOHHHWQTBPZFAO-DDWIOCJRSA-N |
| SMILES | C1CCCC(CC1)[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)