CAS 2940879-50-3 is the registry number for (S)-2-Amino-2-cycloheptylacetic acid hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2S)-2-amino-2-cycloheptylacetic acid;hydrochloride (CAS 2940879-50-3) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: (2S)-2-amino-2-cycloheptylacetic acid;hydrochloride. InChIKey: FOHHHWQTBPZFAO-QRPNPIFTSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (2S)-2-amino-2-cycloheptylacetic acid;hydrochloride |
| InChIKey | FOHHHWQTBPZFAO-QRPNPIFTSA-N |
| SMILES | C1CCCC(CC1)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)