Products 2940879-84-3
CAS 2940879-84-3 is the registry number for ethyl 4-[(2S)-2-aminopropyl]thiazole-2-carboxylate,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
Ethyl 4-[(2S)-2-aminopropyl]-1,3-thiazole-2-carboxylate;hydrochloride (CAS 2940879-84-3) is a chemical compound with the molecular formula C9H15ClN2O2S and a molecular weight of 250.75 g/mol. IUPAC name: ethyl 4-[(2S)-2-aminopropyl]-1,3-thiazole-2-carboxylate;hydrochloride. InChIKey: FOOHYZJUWGPGKB-RGMNGODLSA-N.
| Molecular formula | C9H15ClN2O2S |
|---|---|
| Molecular weight | 250.75 g/mol |
| IUPAC name | ethyl 4-[(2S)-2-aminopropyl]-1,3-thiazole-2-carboxylate;hydrochloride |
| InChIKey | FOOHYZJUWGPGKB-RGMNGODLSA-N |
| SMILES | CCOC(=O)C1=NC(=CS1)C[C@H](C)N.Cl |
Computed by PubChem (NCBI)