Products 2940933-81-1
CAS 2940933-81-1 is the registry number for methyl (2S)-2-(2-methoxyphenyl)pyrrolidine-3-carboxylate,hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl (2S)-2-(2-methoxyphenyl)pyrrolidine-3-carboxylate;hydrochloride (CAS 2940933-81-1) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: methyl (2S)-2-(2-methoxyphenyl)pyrrolidine-3-carboxylate;hydrochloride. InChIKey: HCPGCBNLJPBICZ-ULIKACSMSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | methyl (2S)-2-(2-methoxyphenyl)pyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | HCPGCBNLJPBICZ-ULIKACSMSA-N |
| SMILES | COC1=CC=CC=C1[C@@H]2C(CCN2)C(=O)OC.Cl |
Computed by PubChem (NCBI)