Products 2940958-62-1

CAS 2940958-62-1 is the registry number for 3-(isopropoxymethyl)azetidine,2,2,2-trifluoroacetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(propan-2-yloxymethyl)azetidine;2,2,2-trifluoroacetic acid (CAS 2940958-62-1) is a chemical compound with the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. IUPAC name: 3-(propan-2-yloxymethyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: ORHVFYHGNXJWQI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16F3NO3
Molecular weight243.22 g/mol
IUPAC name3-(propan-2-yloxymethyl)azetidine;2,2,2-trifluoroacetic acid
InChIKeyORHVFYHGNXJWQI-UHFFFAOYSA-N
SMILESCC(C)OCC1CNC1.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)