Products 2940963-16-4

CAS 2940963-16-4 is the registry number for 3-(Propoxymethyl)azetidine 2,2,2-trifluoroacetate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

3-(propoxymethyl)azetidine;2,2,2-trifluoroacetic acid (CAS 2940963-16-4) is a chemical compound with the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. IUPAC name: 3-(propoxymethyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: XQPRMXMRFMJRTB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16F3NO3
Molecular weight243.22 g/mol
IUPAC name3-(propoxymethyl)azetidine;2,2,2-trifluoroacetic acid
InChIKeyXQPRMXMRFMJRTB-UHFFFAOYSA-N
SMILESCCCOCC1CNC1.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)