CAS 610272-57-6 is the registry number for tert-Butyl (S)-(4,4,4-trifluoro-1-hydroxybutan-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]carbamate (CAS 610272-57-6) is a chemical compound with the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. IUPAC name: tert-butyl N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]carbamate. InChIKey: YQODVUUZNPHLQT-LURJTMIESA-N.
| Molecular formula | C9H16F3NO3 |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | tert-butyl N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]carbamate |
| InChIKey | YQODVUUZNPHLQT-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(F)(F)F)CO |
Computed by PubChem (NCBI)