Products 29411-57-2
CAS 29411-57-2 appears in our catalog under these names: Methyl-alpha-altropyranoside, Methyl a-D-altropyranoside. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 2g, 1g, 5g, 10g.
(2R,3S,4R,5S,6S)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol (CAS 29411-57-2) is a chemical compound with the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. IUPAC name: (2R,3S,4R,5S,6S)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol. InChIKey: HOVAGTYPODGVJG-OVHBTUCOSA-N.
| Molecular formula | C7H14O6 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2R,3S,4R,5S,6S)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol |
| InChIKey | HOVAGTYPODGVJG-OVHBTUCOSA-N |
| SMILES | CO[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)