CAS 93302-26-2 appears in our catalog under these names: (2R,3R,4S,5R)–2–(Hydroxymethyl)–6–methoxytetrahydro–2H–pyran–3,4,5–triol, Methyl D-galactopyranoside, Methyl-D-galactoside 95%, (2R,3R,4S,5R)-2-(Hydroxymethyl)-6-methoxytetrahydro-2H-pyran-3,4,5-triol, 95%, 95%, Methyl-D-galactoside. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 5g, 50g, 25g, 100g, 250g, 1 g, 10 g.
(2R,3R,4S,5R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol (CAS 93302-26-2) is a chemical compound with the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol. InChIKey: HOVAGTYPODGVJG-TVPFVARWSA-N.
| Molecular formula | C7H14O6 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol |
| InChIKey | HOVAGTYPODGVJG-TVPFVARWSA-N |
| SMILES | COC1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)