Products 51224-38-5
CAS 51224-38-5 appears in our catalog under these names: Methyl beta-D-Altropyranoside, Methyl b-D-altropyranoside. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 1g.
(2R,3S,4R,5S,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol (CAS 51224-38-5) is a chemical compound with the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. IUPAC name: (2R,3S,4R,5S,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol. InChIKey: HOVAGTYPODGVJG-BNWJMWRWSA-N.
| Molecular formula | C7H14O6 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2R,3S,4R,5S,6R)-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol |
| InChIKey | HOVAGTYPODGVJG-BNWJMWRWSA-N |
| SMILES | CO[C@H]1[C@H]([C@@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)