CAS 700810-97-5 is the registry number for 6-Chloro-2-methyl-N-phenylpyrimidin-4-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-chloro-2-methyl-N-phenylpyrimidin-4-amine (CAS 700810-97-5) is a chemical compound with the molecular formula C11H10ClN3 and a molecular weight of 219.67 g/mol. IUPAC name: 6-chloro-2-methyl-N-phenylpyrimidin-4-amine. InChIKey: SKHBMHOHFOFERO-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3 |
|---|---|
| Molecular weight | 219.67 g/mol |
| IUPAC name | 6-chloro-2-methyl-N-phenylpyrimidin-4-amine |
| InChIKey | SKHBMHOHFOFERO-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)Cl)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)