Products 294180-07-7

CAS 294180-07-7 is the registry number for Methyl 3-(4-aminopiperidin-1-yl)propanoate dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 3-(4-aminopiperidin-1-yl)propanoate;dihydrochloride (CAS 294180-07-7) is a chemical compound with the molecular formula C9H20Cl2N2O2 and a molecular weight of 259.17 g/mol. IUPAC name: methyl 3-(4-aminopiperidin-1-yl)propanoate;dihydrochloride. InChIKey: WOQSMSMXSRFZEX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H20Cl2N2O2
Molecular weight259.17 g/mol
IUPAC namemethyl 3-(4-aminopiperidin-1-yl)propanoate;dihydrochloride
InChIKeyWOQSMSMXSRFZEX-UHFFFAOYSA-N
SMILESCOC(=O)CCN1CCC(CC1)N.Cl.Cl

Computed by PubChem (NCBI)