CAS 29446-15-9 is the registry number for 2,3-Dichlorodibenzo-p-dioxin, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 50mg, 5mg.
2,3-dichlorodibenzo-p-dioxin (CAS 29446-15-9) is a chemical compound with the molecular formula C12H6Cl2O2 and a molecular weight of 253.08 g/mol. IUPAC name: 2,3-dichlorodibenzo-p-dioxin. InChIKey: YCIYTXRUZSDMRZ-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2O2 |
|---|---|
| Molecular weight | 253.08 g/mol |
| IUPAC name | 2,3-dichlorodibenzo-p-dioxin |
| InChIKey | YCIYTXRUZSDMRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)OC3=CC(=C(C=C3O2)Cl)Cl |
Computed by PubChem (NCBI)