CAS 33857-26-0 appears in our catalog under these names: 2,7-Dibenzodichloro-p-dioxin, 2,7-Dichlorodibenzo-p-dioxin, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
2,7-dichlorodibenzo-p-dioxin (CAS 33857-26-0) is a chemical compound with the molecular formula C12H6Cl2O2 and a molecular weight of 253.08 g/mol. IUPAC name: 2,7-dichlorodibenzo-p-dioxin. InChIKey: NBFMTHWVRBOVPE-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2O2 |
|---|---|
| Molecular weight | 253.08 g/mol |
| IUPAC name | 2,7-dichlorodibenzo-p-dioxin |
| InChIKey | NBFMTHWVRBOVPE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC3=C(O2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)