CAS 38964-22-6 appears in our catalog under these names: 2,8-Dichlorodibenzo-p-Dioxin, Triclosan Impurity 9, Triclosan Impurity 4, 2,8-Dichlorodibenzo(b,e)(1,4)dioxin. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2,8-dichlorodibenzo-p-dioxin (CAS 38964-22-6) is a chemical compound with the molecular formula C12H6Cl2O2 and a molecular weight of 253.08 g/mol. IUPAC name: 2,8-dichlorodibenzo-p-dioxin. InChIKey: WMWJCKBJUQDYLM-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2O2 |
|---|---|
| Molecular weight | 253.08 g/mol |
| IUPAC name | 2,8-dichlorodibenzo-p-dioxin |
| InChIKey | WMWJCKBJUQDYLM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC3=C(O2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)