Products 2947424-59-9
CAS 2947424-59-9 is the registry number for 5-{[(tert-butoxy)carbonyl]amino}spiro[2.3]hexane-5-carboxylic acid. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-[(2-methylpropan-2-yl)oxycarbonylamino]spiro[2.3]hexane-5-carboxylic acid (CAS 2947424-59-9) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonylamino]spiro[2.3]hexane-5-carboxylic acid. InChIKey: SRRNSTBELOIFCA-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]spiro[2.3]hexane-5-carboxylic acid |
| InChIKey | SRRNSTBELOIFCA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC2(C1)CC2)C(=O)O |
Computed by PubChem (NCBI)