CAS 294877-29-5 appears in our catalog under these names: 1–(3–Bromophenyl)–3,5–dimethyl–1H–pyrazole, 1-(3-Bromophenyl)-3,5-dimethylpyrazole, 1-(3-Bromophenyl)-3,5-dimethyl-1H-pyrazole 97%, 1-(3-Bromophenyl)-3,5-dimethylpyrazole, 97%, 97%, 1-(3-Bromophenyl)-3,5-dimethyl-1H-pyrazole, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100mg.
1-(3-bromophenyl)-3,5-dimethylpyrazole (CAS 294877-29-5) is a chemical compound with the molecular formula C11H11BrN2 and a molecular weight of 251.12 g/mol. IUPAC name: 1-(3-bromophenyl)-3,5-dimethylpyrazole. InChIKey: KPIAAVHCRHKNRT-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2 |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 1-(3-bromophenyl)-3,5-dimethylpyrazole |
| InChIKey | KPIAAVHCRHKNRT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC(=CC=C2)Br)C |
Computed by PubChem (NCBI)