CAS 294893-24-6 is the registry number for 6-Hydroxy-2-((2-(1H-indol-3-yl)-2-oxoethyl)thio)-4(3H)-pyrimidinone. Offered by: TRC. Available pack sizes: 250mg.
4-hydroxy-2-[2-(1H-indol-3-yl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one (CAS 294893-24-6) is a chemical compound with the molecular formula C14H11N3O3S and a molecular weight of 301.32 g/mol. IUPAC name: 4-hydroxy-2-[2-(1H-indol-3-yl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one. InChIKey: TZNQICICOBQVNI-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O3S |
|---|---|
| Molecular weight | 301.32 g/mol |
| IUPAC name | 4-hydroxy-2-[2-(1H-indol-3-yl)-2-oxoethyl]sulfanyl-1H-pyrimidin-6-one |
| InChIKey | TZNQICICOBQVNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)CSC3=NC(=CC(=O)N3)O |
Computed by PubChem (NCBI)