CAS 307327-52-2 appears in our catalog under these names: 2-{(5-(Furan-2-yl)-4-phenyl-4H-1,2,4-triazol-3-yl)sulfanyl}acetic acid, 2-([5-(Furan-2-yl)-4-phenyl-4h-1,2,4-triazol-3-yl]sulfanyl)acetic acid, 95%, 2-((5-(Furan-2-yl)-4-phenyl-4H-1,2,4-triazol-3-yl)thio)acetic acid, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 250mg, 5g, 10g, 100mg, 1g.
2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid (CAS 307327-52-2) is a chemical compound with the molecular formula C14H11N3O3S and a molecular weight of 301.32 g/mol. IUPAC name: 2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid. InChIKey: AHAPZORVJXZWPX-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O3S |
|---|---|
| Molecular weight | 301.32 g/mol |
| IUPAC name | 2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| InChIKey | AHAPZORVJXZWPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NN=C2SCC(=O)O)C3=CC=CO3 |
Computed by PubChem (NCBI)